CAS 117320-66-8: 4-AMINO-5-(3-CHLOROPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL
Description:4-Amino-5-(3-chlorophenyl)-4H-1,2,4-triazole-3-thiol, with the CAS number 117320-66-8, is a heterocyclic compound characterized by the presence of a triazole ring, an amino group, and a thiol functional group. This compound typically exhibits properties associated with both its aromatic and heterocyclic structures, including potential biological activity. The presence of the 3-chlorophenyl group may enhance its lipophilicity and influence its interaction with biological targets. The amino and thiol groups can participate in hydrogen bonding and redox reactions, making the compound potentially useful in various chemical and pharmaceutical applications. It may also exhibit antimicrobial or antifungal properties, which are common in triazole derivatives. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 4-amino-5-(3-chlorophenyl)-4H-1,2,4-triazole-3-thiol represents a class of compounds that are of interest in medicinal chemistry and agricultural chemistry for their potential therapeutic and protective roles.
Formula:C8H7ClN4S
InChI:InChI=1/C8H7ClN4S/c9-6-3-1-2-5(4-6)7-11-12-8(14)13(7)10/h1-4H,10H2,(H,12,14)
- Synonyms:
- 4H-1,2,4-triazole-3-thiol, 4-amino-5-(3-chlorophenyl)-
- 4-amino-5-(3-chlorophenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3H-1,2,4-Triazole-3-thione, 4-amino-5-(3-chlorophenyl)-2,4-dihydro- REF: IN-DA000E49CAS: 117320-66-8 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 4-amino-3-(3-chlorophenyl)-4,5-dihydro-1H-1,2,4-triazole-5-thione REF: 10-F643363CAS: 117320-66-8 | 97% | To inquire | Tue 08 Apr 25 |
![]() | 4-Amino-5-(3-chlorophenyl)-4H-1,2,4-triazole-3-thiol REF: 3D-FA126883CAS: 117320-66-8 | Min. 95% | - - - | Discontinued product |

3H-1,2,4-Triazole-3-thione, 4-amino-5-(3-chlorophenyl)-2,4-dihydro-
Ref: IN-DA000E49
Undefined size | To inquire |

4-amino-3-(3-chlorophenyl)-4,5-dihydro-1H-1,2,4-triazole-5-thione
Ref: 10-F643363
1g | To inquire | ||
5g | To inquire | ||
10g | To inquire | ||
2.5g | To inquire | ||
50mg | To inquire | ||
100mg | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |

4-Amino-5-(3-chlorophenyl)-4H-1,2,4-triazole-3-thiol
Ref: 3D-FA126883
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |