CAS 117323-99-6: ethyl 2-amino-4-bromobenzoate

Description: Ethyl 2-amino-4-bromobenzoate, with the CAS number 117323-99-6, is an organic compound that belongs to the class of benzoate esters. It features a bromine atom and an amino group attached to a benzene ring, which contributes to its reactivity and potential applications in organic synthesis. The presence of the ethyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions. This compound is typically characterized by its moderate polarity, which allows it to participate in nucleophilic substitution reactions. Additionally, the amino group can act as a site for further functionalization, enabling the synthesis of more complex molecules. Ethyl 2-amino-4-bromobenzoate may also exhibit biological activity, making it of interest in pharmaceutical research. Its physical properties, such as melting point and boiling point, can vary based on purity and specific conditions. Overall, this compound serves as a valuable intermediate in the synthesis of various chemical entities in medicinal chemistry and materials science.

Formula: C₉H₁₀BrNO₂

InChI: InChI=1/C9H10BrNO2/c1-2-13-9(12)7-4-3-6(10)5-8(7)11/h3-5H,2,11H2,1H3

Synonyms:

• benzoic acid, 2-amino-4-bromo-, ethyl ester

Benzoic acid, 2-aMino-4-broMo-, ethyl ester

CAS: 117323-99-6

• Formula: C₉H₁₀BrNO₂
• Molecular weight: 244.0852

Ethyl 2-amino-4-bromobenzoate

CAS: 117323-99-6

• Purity: 98%
• Molecular weight: 244.08799743652344

ethyl 2-amino-4-bromobenzoate

CAS: 117323-99-6

Ethyl 2-amino-4-bromobenzoate is a synthetic, analog of salicylic acid that binds to the Mcl-1 protein …

• Formula: C₉H₁₀BrNO₂
• Purity: Min. 95%
• Molecular weight: 244.09 g/mol