CAS 1175536-50-1: 2,3-Butanediol, 2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)-, (2R,3R)-, methanesulfonate (1:1)
Description:2,3-Butanediol, 2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)-, (2R,3R)-, methanesulfonate (1:1) is a complex organic compound characterized by its specific stereochemistry and functional groups. The presence of the butanediol moiety indicates that it has hydroxyl (-OH) groups, which contribute to its solubility in polar solvents and potential reactivity in various chemical reactions. The difluorophenyl group introduces significant electronegativity, which can influence the compound's electronic properties and interactions with biological targets. The triazole ring is known for its stability and ability to form hydrogen bonds, making it a common scaffold in pharmaceuticals. The methanesulfonate group serves as a counterion, enhancing the compound's solubility and stability in solution. Overall, this compound may exhibit interesting biological activities due to its diverse functional groups, making it a candidate for further research in medicinal chemistry and related fields. Its specific applications would depend on the interactions of its various components with biological systems.
Formula:C12H13F2N3O2·CH4O3S
InChI:InChI=1S/C12H13F2N3O2.CH4O3S/c1-8(18)12(19,5-17-7-15-6-16-17)10-3-2-9(13)4-11(10)14;1-5(2,3)4/h2-4,6-8,18-19H,5H2,1H3;1H3,(H,2,3,4)/t8-,12-;/m1./s1
InChI key:InChIKey=RWPFLARVZWFRBO-DAIXLEOSSA-N
SMILES:O=S(=O)(O)C.FC1=CC=C(C(F)=C1)C(O)(CN2N=CN=C2)C(O)C
- Synonyms:
- (2R,3R)-2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)butane-2,3-diol Mesylate
- 2,3-Butanediol, 2-(2,4-difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)-, (2R,3R)-, methanesulfonate (1:1)
