CAS 1177334-28-9: N-[3-(1H-Imidazol-1-yl)propyl]-4-methyl-2-benzothiazolamine
Description:N-[3-(1H-Imidazol-1-yl)propyl]-4-methyl-2-benzothiazolamine is a chemical compound characterized by its unique structural features, which include an imidazole ring and a benzothiazole moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as potential biological activity and solubility in organic solvents. The presence of the imidazole group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The benzothiazole portion may contribute to its stability and reactivity, as well as influence its electronic properties. Additionally, the amine functional group can participate in hydrogen bonding, enhancing its potential interactions in biological systems. Overall, this compound may be explored for applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways or conditions. Its specific characteristics, such as melting point, solubility, and reactivity, would require empirical investigation to fully understand its behavior in various environments.
Formula:C14H16N4S
InChI:InChI=1S/C14H16N4S/c1-11-4-2-5-12-13(11)17-14(19-12)16-6-3-8-18-9-7-15-10-18/h2,4-5,7,9-10H,3,6,8H2,1H3,(H,16,17)
InChI key:InChIKey=RVWKAYAQXDKUQJ-UHFFFAOYSA-N
SMILES:N=1C=CN(C1)CCCNC2=NC=3C(S2)=CC=CC3C
- Synonyms:
- 2-Benzothiazolamine, N-[3-(1H-imidazol-1-yl)propyl]-4-methyl-
- N-[3-(1H-Imidazol-1-yl)propyl]-4-methyl-2-benzothiazolamine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | N-[3-(1H-imidazol-1-yl)propyl]-4-methyl-1,3-benzothiazol-2-amine REF: 10-F495561CAS: 1177334-28-9 | 95.0% | To inquire | Tue 08 Apr 25 |
![]() | N-[3-(1H-Imidazol-1-yl)propyl]-4-methyl-1,3-benzothiazol-2-amine REF: 3D-CXB33428CAS: 1177334-28-9 | Min. 95% | - - - | Discontinued product |

N-[3-(1H-imidazol-1-yl)propyl]-4-methyl-1,3-benzothiazol-2-amine
Ref: 10-F495561
250mg | To inquire | ||
500mg | To inquire |

N-[3-(1H-Imidazol-1-yl)propyl]-4-methyl-1,3-benzothiazol-2-amine
Ref: 3D-CXB33428
1g | Discontinued | Request information | |
10mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |