CAS 117796-52-8: 11-(1-Acetyl-4-piperidylidene)-8-chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridine
Description:11-(1-Acetyl-4-piperidylidene)-8-chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridine, with CAS number 117796-52-8, is a chemical compound that belongs to a class of heterocyclic compounds. It features a complex bicyclic structure that incorporates both a piperidine and a chloro group, contributing to its unique chemical properties. The presence of the acetyl group suggests potential reactivity and the ability to participate in various chemical reactions, such as acylation or nucleophilic substitutions. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structural characteristics may influence its solubility, stability, and interaction with biological targets. As with many compounds of this nature, understanding its properties requires further investigation through experimental studies, including its synthesis, characterization, and potential applications in drug discovery or other fields. Safety and handling precautions should be observed due to the presence of chlorine and the potential for biological activity.
Formula:C21H21ClN2O
InChI:InChI=1/C21H21ClN2O/c1-14(25)24-11-8-15(9-12-24)20-19-7-6-18(22)13-17(19)5-4-16-3-2-10-23-21(16)20/h2-3,6-7,10,13H,4-5,8-9,11-12H2,1H3
- Synonyms:
- Sch-37370
- 1-[4-(8-chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)piperidin-1-yl]ethanone