
CAS 1178797-22-2: N-(2,2-Difluoroethyl)-4-morpholineethanamine
Description:N-(2,2-Difluoroethyl)-4-morpholineethanamine, identified by its CAS number 1178797-22-2, is a chemical compound characterized by the presence of a morpholine ring and a difluoroethyl substituent. This compound features a morpholine moiety, which is a six-membered ring containing both oxygen and nitrogen atoms, contributing to its potential as a versatile building block in medicinal chemistry. The difluoroethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical applications. The presence of amine functionality suggests potential for hydrogen bonding and reactivity, which can be advantageous in drug design. Additionally, the fluorine atoms can impart unique electronic properties, potentially affecting the compound's interaction with biological targets. Overall, this compound's structural features suggest it may exhibit interesting pharmacological properties, warranting further investigation in the context of drug development and chemical synthesis.
Formula:C8H16F2N2O
InChI:InChI=1S/C8H16F2N2O/c9-8(10)7-11-1-2-12-3-5-13-6-4-12/h8,11H,1-7H2
InChI key:InChIKey=UCBDLUXNBMRCPK-UHFFFAOYSA-N
SMILES:FC(F)CNCCN1CCOCC1
- Synonyms:
- N-(2,2-Difluoroethyl)-4-morpholineethanamine
- 4-Morpholineethanamine, N-(2,2-difluoroethyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | N-(2,2-difluoroethyl)-N-(2-morpholin-4-ylethyl)amine REF: 10-F428518CAS: 1178797-22-2 | 95% | - - - | Discontinued product |
![]() | (2,2-Difluoroethyl)[2-(morpholin-4-yl)ethyl]amine REF: 3D-DXB79722CAS: 1178797-22-2 | Min. 95% | - - - | Discontinued product |

N-(2,2-difluoroethyl)-N-(2-morpholin-4-ylethyl)amine
Ref: 10-F428518
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

(2,2-Difluoroethyl)[2-(morpholin-4-yl)ethyl]amine
Ref: 3D-DXB79722
5mg | Discontinued | Request information | |
50mg | Discontinued | Request information |