CAS 117976-92-8: 3-[[2-(Chloromethyl)-3-methyl-4-pyridinyl]oxy]-1-propanol
Description:3-[[2-(Chloromethyl)-3-methyl-4-pyridinyl]oxy]-1-propanol, with the CAS number 117976-92-8, is a chemical compound characterized by its unique structure that includes a pyridine ring substituted with a chloromethyl group and an ether linkage to a propanol moiety. This compound typically exhibits properties associated with both alcohols and heterocyclic compounds, such as moderate polarity and potential for hydrogen bonding due to the hydroxyl group. The presence of the chloromethyl group may impart reactivity, making it a candidate for further chemical transformations. Additionally, the pyridine ring can influence the compound's biological activity, potentially contributing to pharmacological properties. Its solubility in polar solvents is expected, while its stability may vary depending on environmental conditions such as pH and temperature. Overall, this compound's characteristics make it of interest in various fields, including medicinal chemistry and materials science, where its unique functional groups can be exploited for specific applications.
Formula:C10H14ClNO2
InChI:InChI=1S/C10H14ClNO2/c1-8-9(7-11)12-4-3-10(8)14-6-2-5-13/h3-4,13H,2,5-7H2,1H3
InChI key:InChIKey=FXJAABZTPUERIP-UHFFFAOYSA-N
SMILES:ClCC1=NC=CC(OCCCO)=C1C

2-chloromethyl-4-(3-hydroxypropoxy)-3-methylpyridine
Ref: IN-DA01M1JS
25mg | 584.00 € |

Ref: 4Z-R-2039
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

3-((2-(Chloromethyl)-3-methylpyridin-4-yl)oxy)propan-1-ol
Ref: 10-F616674
1g | To inquire | ||
50mg | To inquire | ||
100mg | To inquire | ||
250mg | To inquire |

3-((2-(Chloromethyl)-3-methylpyridin-4-yl)oxy)propan-1-ol
Ref: 3D-SEA97692
25mg | 331.00 € | ||
50mg | 373.00 € | ||
100mg | 531.00 € | ||
250mg | 823.00 € |