CAS 118-41-2: 3,4,5-Trimethoxybenzoic acid
Description:3,4,5-Trimethoxybenzoic acid, with the CAS number 118-41-2, is an aromatic carboxylic acid characterized by the presence of three methoxy groups (-OCH3) attached to a benzene ring, specifically at the 3, 4, and 5 positions relative to the carboxylic acid group (-COOH). This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic methoxy groups. It exhibits properties typical of benzoic acids, including the ability to form salts and esters. The presence of methoxy groups can influence its reactivity and stability, often enhancing its lipophilicity and potentially affecting its biological activity. 3,4,5-Trimethoxybenzoic acid is of interest in various fields, including organic synthesis and medicinal chemistry, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. Its specific applications can vary, but it is often studied for its potential pharmacological properties.
Formula:C10H11O5
InChI:InChI=1S/C10H12O5/c1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h4-5H,1-3H3,(H,11,12)
InChI key:InChIKey=SJSOFNCYXJUNBT-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC(OC)=C(OC)C(OC)=C1
- Synonyms:
- 3,4,5-Trimethoxy Benzoic Acid
- 3,4,5-Trimethoxybenzoate
- 3,4,5-Trimethoxybenzoesaeure
- 3,4,5-Trimethoxybenzoesaure
- Acide 3,4,5-trimethoxybenzoique
- Acido 3,4,5-Trimetoxibenzoico
- Benzoic acid, 3,4,5-trimethoxy-
- Eudesmic acid
- Gallic acid trimethyl ether
- Nsc 2525
- See more synonyms
- Tri-O-methylgallic acid
- Trimethylgallic acid
