CAS 118121-82-7: 4-(4-CHLORO-6-METHYL-2-PYRIMIDINYL)MORPHOLINE
Description:4-(4-Chloro-6-methyl-2-pyrimidinyl)morpholine, with the CAS number 118121-82-7, is a chemical compound that features a morpholine ring substituted with a pyrimidine moiety. This compound is characterized by its heterocyclic structure, which includes a chlorine atom and a methyl group on the pyrimidine ring, contributing to its unique chemical properties. Morpholines are known for their versatility in medicinal chemistry, often serving as building blocks in drug design due to their ability to interact with biological targets. The presence of the chloro and methyl groups can influence the compound's lipophilicity, solubility, and overall biological activity. This compound may exhibit potential pharmacological properties, making it of interest in the development of therapeutic agents. Its synthesis and reactivity can be influenced by the electronic and steric effects of the substituents, which are critical in determining its behavior in chemical reactions and interactions with biological systems.
Formula:C9H12ClN3O
InChI:InChI=1/C9H12ClN3O/c1-7-6-8(10)12-9(11-7)13-2-4-14-5-3-13/h6H,2-5H2,1H3
- Synonyms:
- 4-(4-Chloro-6-methylpyrimidin-2-yl)morpholine
- Morpholine, 4-(4-chloro-6-methyl-2-pyrimidinyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-(4-chloro-6-methyl-2-pyrimidinyl)morpholine REF: 10-F310492CAS: 118121-82-7 | 95.0% | - - - | Discontinued product |
![]() | 4-(4-Chloro-6-methyl-2-pyrimidinyl)morpholine REF: 3D-TEA12182CAS: 118121-82-7 | Min. 95% | - - - | Discontinued product |

4-(4-chloro-6-methyl-2-pyrimidinyl)morpholine
Ref: 10-F310492
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |

4-(4-Chloro-6-methyl-2-pyrimidinyl)morpholine
Ref: 3D-TEA12182
25mg | Discontinued | Request information | |
250mg | Discontinued | Request information |