CAS 118129-60-5: 5,12-dibromoisochromeno[4',5',6':6,5,10]anthra[2,1,9-def]isochromene-1,3,8,10-tetrone
Description:5,12-Dibromoisochromeno[4',5',6':6,5,10]anthra[2,1,9-def]isochromene-1,3,8,10-tetrone is a complex organic compound characterized by its unique polycyclic structure, which incorporates both isochromene and anthraquinone moieties. This compound features multiple bromine substituents, which can significantly influence its chemical reactivity and physical properties, such as solubility and stability. The presence of the tetrone functional groups suggests that it may exhibit strong electron-accepting properties, making it potentially useful in various applications, including organic electronics and photonic devices. Additionally, the intricate arrangement of fused rings contributes to its potential as a fluorescent or luminescent material. The compound's synthesis typically involves multi-step organic reactions, and its characterization can be performed using techniques such as NMR spectroscopy, mass spectrometry, and UV-Vis spectroscopy. Overall, 5,12-dibromoisochromeno[4',5',6':6,5,10]anthra[2,1,9-def]isochromene-1,3,8,10-tetrone represents a fascinating subject of study in the field of organic chemistry due to its structural complexity and potential applications.
Formula:C24H6Br2O6
InChI:InChI=1/C24H6Br2O6/c25-13-5-12-16-10(22(28)32-24(12)30)4-2-8-18-14(26)6-11-15-9(21(27)31-23(11)29)3-1-7(19(15)18)17(13)20(8)16/h1-6H