CAS 118291-90-0: 2-chloro-4-nitrophenylmaltotrioside
Description:2-Chloro-4-nitrophenylmaltotrioside is a synthetic compound that belongs to the class of glycosides, specifically a maltotrioside derivative. It features a maltotrioside moiety, which is a carbohydrate composed of three glucose units linked together, and is modified by the presence of a 2-chloro-4-nitrophenyl group. This substitution introduces both a chlorine atom and a nitro group, which can influence the compound's reactivity and solubility. The presence of the nitro group typically enhances the compound's electrophilicity, making it useful in various chemical reactions, including those involving nucleophiles. This compound is often utilized in biochemical research, particularly in studies related to enzyme activity, as it can serve as a substrate for glycoside hydrolases. Its unique structural features may also impart specific biological activities, making it of interest in pharmacological studies. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C24H34ClNO18
InChI:InChI=1/C24H34ClNO18/c25-9-3-7(26(38)39)1-2-8(9)24(44-23-20(37)17(34)14(31)11(5-28)41-23)21(18(35)15(32)12(6-29)43-24)42-22-19(36)16(33)13(30)10(4-27)40-22/h1-3,10-23,27-37H,4-6H2/t10-,11-,12-,13-,14-,15-,16+,17+,18+,19-,20-,21-,22-,23-,24-/m1/s1
- Synonyms:
- 2-Chloro-4-nitrophenyl-α-D-maltotrioside