
CAS 1185297-97-5: 1H-1,2,4-Triazole-5-ethanamine, 3-[(3-methylphenyl)methyl]-, hydrochloride (1:1)
Description:1H-1,2,4-Triazole-5-ethanamine, 3-[(3-methylphenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an ethylamine side chain and a 3-methylphenyl group, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the triazole moiety suggests potential antifungal or antimicrobial properties, as triazoles are known for their role in inhibiting fungal cytochrome P450 enzymes. The compound's specific interactions and efficacy would depend on its molecular structure and the functional groups present. Safety and handling precautions should be observed, as with any chemical, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological profile and applications in medicinal chemistry.
Formula:C12H16N4·ClH
InChI:InChI=1S/C12H16N4.ClH/c1-9-3-2-4-10(7-9)8-12-14-11(5-6-13)15-16-12;/h2-4,7H,5-6,8,13H2,1H3,(H,14,15,16);1H
InChI key:InChIKey=OBEPEOJQNVOZKV-UHFFFAOYSA-N
SMILES:Cl.N=1N=C(NC1CC=2C=CC=C(C2)C)CCN
- Synonyms:
- 1H-1,2,4-Triazole-5-ethanamine, 3-[(3-methylphenyl)methyl]-, hydrochloride (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | {2-[3-(3-Methylbenzyl)-1H-1,2,4-triazol-5-yl]ethyl}amine hydrochloride REF: 3D-FM119668CAS: 1185297-97-5 | Min. 95% | - - - | Discontinued product |

{2-[3-(3-Methylbenzyl)-1H-1,2,4-triazol-5-yl]ethyl}amine hydrochloride
Ref: 3D-FM119668
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |