CAS 1186334-63-3: 4-Bromo-7-fluoro-1H-indazole

Description:4-Bromo-7-fluoro-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring. The presence of bromine and fluorine substituents at the 4 and 7 positions, respectively, significantly influences its chemical properties and reactivity. This compound typically exhibits moderate to high lipophilicity due to the halogen substituents, which can enhance its biological activity and interaction with various targets. It may also display interesting electronic properties, making it a candidate for applications in medicinal chemistry and material science. The compound's structure allows for potential hydrogen bonding and π-π stacking interactions, which are relevant in drug design and molecular recognition processes. Additionally, 4-Bromo-7-fluoro-1H-indazole may undergo typical reactions associated with halogenated compounds, such as nucleophilic substitutions or electrophilic aromatic substitutions, depending on the reaction conditions. Its unique combination of features makes it a subject of interest in research, particularly in the development of pharmaceuticals and agrochemicals.

Formula:C₇H₄BrFN₂

InChI:InChI=1S/C7H4BrFN2/c8-5-1-2-6(9)7-4(5)3-10-11-7/h1-3H,(H,10,11)

InChI key:InChIKey=ZDXVNDLMTIOXRC-UHFFFAOYSA-N

SMILES:FC1=CC=C(Br)C=2C=NNC12

Synonyms:
1H-Indazole, 4-bromo-7-fluoro-
4-Bromo-7-fluoro-1H-indazole

Found 5 products.

Product data	Purity	Price range	Estimated delivery
1H-Indazole, 4-broMo-7-fluoro- REF: IN-DA0096T6CAS: 1186334-63-3	98%	25.00 €~576.00 €	Tue 04 Mar 25
4-Bromo-7-fluoro-1H-indazole REF: 10-F383614CAS: 1186334-63-3	95.0%	50.00 €~1,947.00 €	Wed 05 Mar 25
4-Bromo-7-fluoro-1H-indazole REF: 54-PC402010CAS: 1186334-63-3	96+%	To inquire	Tue 11 Mar 25
4-BROMO-7-FLUORO-1H-INDAZOLE REF: 10-F794344CAS: 1186334-63-3	95%	To inquire	Wed 12 Mar 25
4-Bromo-7-fluoro-1H-indazole REF: 3D-LXB33463CAS: 1186334-63-3	Min. 95%	To inquire	Tue 15 Apr 25