CAS 1187166-16-0: (4-Nitrophenyl)-3-quinolinylmethanone

Description:(4-Nitrophenyl)-3-quinolinylmethanone is an organic compound characterized by its complex structure, which includes a quinoline moiety and a nitrophenyl group. This compound typically exhibits a yellow crystalline appearance due to the presence of the nitro group, which can influence its electronic properties and reactivity. It is likely to be soluble in organic solvents, such as dimethyl sulfoxide or acetone, while being less soluble in water due to its hydrophobic quinoline structure. The presence of the nitro group can impart significant polar character, affecting its interactions in various chemical environments. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its reactivity can be influenced by the functional groups present, allowing for potential applications in synthesis and as a precursor in the development of more complex molecules. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.

Formula:C₁₆H₁₀N₂O₃

InChI:InChI=1S/C16H10N2O3/c19-16(11-5-7-14(8-6-11)18(20)21)13-9-12-3-1-2-4-15(12)17-10-13/h1-10H

InChI key:InChIKey=LYDYXEFKQLAQOT-UHFFFAOYSA-N

SMILES:O=C(C1=CC=C(C=C1)N(=O)=O)C2=CN=C3C=CC=CC3=C2

Synonyms:
Methanone, (4-nitrophenyl)-3-quinolinyl-
(4-Nitrophenyl)-3-quinolinylmethanone

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	3-(4-Nitrobenzoyl)quinoline REF: 10-F203278CAS: 1187166-16-0	97.0%	- - -	Discontinued product
	3-(4-Nitrobenzoyl)quinoline REF: 3D-MXB16616CAS: 1187166-16-0	Min. 95%	- - -	Discontinued product