CAS 1187166-56-8: (3-Iodophenyl)(4-methyl-3-pyridinyl)methanone
Description:(3-Iodophenyl)(4-methyl-3-pyridinyl)methanone, identified by its CAS number 1187166-56-8, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with iodine and a pyridine ring with a methyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl group. The iodine atom can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The methyl group on the pyridine ring may affect the electronic properties and steric hindrance, influencing its interactions in biological or chemical systems. Additionally, the presence of both aromatic and heteroaromatic systems suggests potential applications in pharmaceuticals or materials science, where such compounds can serve as intermediates or active ingredients. Overall, the unique combination of functional groups and structural features makes this compound of interest in synthetic organic chemistry and medicinal chemistry research.
Formula:C13H10INO
InChI:InChI=1S/C13H10INO/c1-9-5-6-15-8-12(9)13(16)10-3-2-4-11(14)7-10/h2-8H,1H3
InChI key:InChIKey=GDBDFDCLZPPMNN-UHFFFAOYSA-N
SMILES:O=C(C=1C=CC=C(I)C1)C=2C=NC=CC2C
- Synonyms:
- (3-Iodophenyl)(4-methyl-3-pyridinyl)methanone
- Methanone, (3-iodophenyl)(4-methyl-3-pyridinyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-(3-Iodobenzoyl)-4-methylpyridine REF: 10-F203340CAS: 1187166-56-8 | 97.0% | - - - | Discontinued product |
![]() | 3-(3-Iodobenzoyl)-4-methylpyridine REF: 3D-MXB16656CAS: 1187166-56-8 | Min. 95% | - - - | Discontinued product |

Ref: 10-F203340
1g | Discontinued | Request information | |
2g | Discontinued | Request information |

3-(3-Iodobenzoyl)-4-methylpyridine
Ref: 3D-MXB16656
1g | Discontinued | Request information | |
5g | Discontinued | Request information |