CAS 1187167-25-4: (6-Methoxy-2-pyridinyl)[4-(1-methylethyl)phenyl]methanone
Description:The chemical substance known as (6-Methoxy-2-pyridinyl)[4-(1-methylethyl)phenyl]methanone, with the CAS number 1187167-25-4, is characterized by its complex molecular structure, which includes a pyridine ring substituted with a methoxy group and a ketone functional group. This compound features a phenyl ring that is further substituted with an isopropyl group, contributing to its hydrophobic characteristics. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the specific arrangement of atoms may impart unique properties, such as selective binding to biological targets or modulation of pharmacokinetic profiles. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, making it a subject of interest in both research and application within the field of organic chemistry.
Formula:C16H17NO2
InChI:InChI=1S/C16H17NO2/c1-11(2)12-7-9-13(10-8-12)16(18)14-5-4-6-15(17-14)19-3/h4-11H,1-3H3
InChI key:InChIKey=KOUISMZZDQEFBS-UHFFFAOYSA-N
SMILES:O=C(C1=NC(OC)=CC=C1)C2=CC=C(C=C2)C(C)C
- Synonyms:
- (6-Methoxy-2-pyridinyl)[4-(1-methylethyl)phenyl]methanone
- Methanone, (6-methoxy-2-pyridinyl)[4-(1-methylethyl)phenyl]-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(4-Isopropylbenzoyl)-6-methoxypyridine REF: 10-F203074CAS: 1187167-25-4 | 97.0% | - - - | Discontinued product |
![]() | 2-(4-Isopropylbenzoyl)-6-methoxypyridine REF: 3D-MXB16725CAS: 1187167-25-4 | Min. 95% | - - - | Discontinued product |

2-(4-Isopropylbenzoyl)-6-methoxypyridine
Ref: 10-F203074
1g | Discontinued | Request information | |
2g | Discontinued | Request information |

2-(4-Isopropylbenzoyl)-6-methoxypyridine
Ref: 3D-MXB16725
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |