CAS 1187171-08-9: (4-Butoxyphenyl)(6-methoxy-2-pyridinyl)methanone

Description:(4-Butoxyphenyl)(6-methoxy-2-pyridinyl)methanone, identified by its CAS number 1187171-08-9, is an organic compound characterized by its complex structure, which includes a butoxy group attached to a phenyl ring and a methanone moiety linked to a pyridine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the butoxy group enhances its solubility in organic solvents, while the methoxy and pyridine functionalities may contribute to its reactivity and interaction with biological systems. It may also display specific optical properties due to its conjugated system. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, detailed information regarding its biological activity, toxicity, and specific applications would require further investigation and empirical data.

Formula:C₁₇H₁₉NO₃

InChI:InChI=1S/C17H19NO3/c1-3-4-12-21-14-10-8-13(9-11-14)17(19)15-6-5-7-16(18-15)20-2/h5-11H,3-4,12H2,1-2H3

InChI key:InChIKey=OHTZUITUONMYLL-UHFFFAOYSA-N

SMILES:O=C(C1=NC(OC)=CC=C1)C2=CC=C(OCCCC)C=C2

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	2-(4-Butoxybenzoyl)-6-methoxypyridine REF: 10-F203085CAS: 1187171-08-9	97.0%	- - -	Discontinued product
	2-(4-Butoxybenzoyl)-6-methoxypyridine REF: 3D-MXB17108CAS: 1187171-08-9	Min. 95%	- - -	Discontinued product