CAS 1187171-36-3: 4-[(6-Chloro-3-pyridinyl)carbonyl]benzonitrile
Description:4-[(6-Chloro-3-pyridinyl)carbonyl]benzonitrile, identified by its CAS number 1187171-36-3, is a chemical compound characterized by its complex structure that includes a benzonitrile moiety and a pyridine ring substituted with a chloro group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The chloro substituent can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. The carbonyl group contributes to its reactivity, potentially allowing for interactions with nucleophiles. This compound may be of interest in medicinal chemistry and material science due to its structural features, which could impart specific biological activities or facilitate the development of novel materials. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Overall, 4-[(6-Chloro-3-pyridinyl)carbonyl]benzonitrile represents a versatile structure with potential applications in various fields of research.
Formula:C13H7ClN2O
InChI:InChI=1S/C13H7ClN2O/c14-12-6-5-11(8-16-12)13(17)10-3-1-9(7-15)2-4-10/h1-6,8H
InChI key:InChIKey=YWUHERVQQOUMFF-UHFFFAOYSA-N
SMILES:N#CC1=CC=C(C=C1)C(=O)C2=CN=C(Cl)C=C2
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Chloro-5-(4-cyanobenzoyl)pyridine REF: 10-F203548CAS: 1187171-36-3 | 97.0% | - - - | Discontinued product |
![]() | 2-Chloro-5-(4-cyanobenzoyl)pyridine REF: 3D-MXB17136CAS: 1187171-36-3 | Min. 95% | - - - | Discontinued product |

Ref: 10-F203548
1g | Discontinued | Request information | |
2g | Discontinued | Request information |

2-Chloro-5-(4-cyanobenzoyl)pyridine
Ref: 3D-MXB17136
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |