CAS 1187171-36-3: 4-[(6-Chloro-3-pyridinyl)carbonyl]benzonitrile

Description: 4-[(6-Chloro-3-pyridinyl)carbonyl]benzonitrile, identified by its CAS number 1187171-36-3, is a chemical compound characterized by its complex structure that includes a benzonitrile moiety and a pyridine ring substituted with a chloro group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The chloro substituent can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. The carbonyl group contributes to its reactivity, potentially allowing for interactions with nucleophiles. This compound may be of interest in medicinal chemistry and material science due to its structural features, which could impart specific biological activities or facilitate the development of novel materials. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Overall, 4-[(6-Chloro-3-pyridinyl)carbonyl]benzonitrile represents a versatile structure with potential applications in various fields of research.

Formula: C₁₃H₇ClN₂O

InChI: InChI=1S/C13H7ClN2O/c14-12-6-5-11(8-16-12)13(17)10-3-1-9(7-15)2-4-10/h1-6,8H

InChI key: InChIKey=YWUHERVQQOUMFF-UHFFFAOYSA-N

SMILES: N#CC1=CC=C(C=C1)C(=O)C2=CN=C(Cl)C=C2

2-Chloro-5-(4-cyanobenzoyl)pyridine

CAS: 1187171-36-3

• Purity: 97.0%
• Molecular weight: 242.66000366210938

2-Chloro-5-(4-cyanobenzoyl)pyridine

CAS: 1187171-36-3

Please enquire for more information about 2-Chloro-5-(4-cyanobenzoyl)pyridine including the price, delivery time and more detailed …

• Formula: C₁₃H₇ClN₂O
• Purity: Min. 95%
• Molecular weight: 242.66 g/mol