CAS 1187386-35-1: 1-(3-Bromo-5-methyl-2-pyridinyl)piperazine

Description: 1-(3-Bromo-5-methyl-2-pyridinyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 3-bromo-5-methyl-2-pyridinyl substituent indicates that the compound has a bromine atom and a methyl group attached to a pyridine ring, which contributes to its unique properties. This structure suggests potential biological activity, as piperazine derivatives are often explored for their pharmacological effects, including anxiolytic and antidepressant properties. The bromine atom can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the compound's molecular structure may exhibit specific solubility characteristics, reactivity, and stability, which are essential for its application in medicinal chemistry and drug development. As with many heterocyclic compounds, the electronic properties of the nitrogen atoms in the piperazine ring and the pyridine ring can play a significant role in its chemical behavior and potential interactions in biological systems.

Formula: C₁₀H₁₄BrN₃

InChI: InChI=1S/C10H14BrN3/c1-8-6-9(11)10(13-7-8)14-4-2-12-3-5-14/h6-7,12H,2-5H2,1H3

InChI key: InChIKey=KSLBPFNANUOETD-UHFFFAOYSA-N

SMILES: BrC1=CC(=CN=C1N2CCNCC2)C

Synonyms:

• Piperazine, 1-(3-bromo-5-methyl-2-pyridinyl)-
• 1-(3-Bromo-5-methyl-2-pyridinyl)piperazine

1-(3-Bromo-5-methylpyridin-2-yl)piperazine

CAS: 1187386-35-1

• Formula: C₁₀H₁₄BrN₃
• Molecular weight: 256.1423

1-(3-Bromo-5-methylpyridin-2-yl)piperazine

CAS: 1187386-35-1

• Purity: 95.0%
• Molecular weight: 256.1470031738281

1-(3-Bromo-5-methylpyridin-2-yl)piperazine

CAS: 1187386-35-1

Versatile small molecule scaffold

• Formula: C₁₀H₁₄BrN₃
• Purity: Min. 95%
• Molecular weight: 256.15 g/mol