CAS 1187386-43-1: 1-Methyl-4-(3-methyl-2-pyridinyl)piperazine
Description:1-Methyl-4-(3-methyl-2-pyridinyl)piperazine, identified by its CAS number 1187386-43-1, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered cyclic amine, substituted with a methyl group at the nitrogen position and a 3-methyl-2-pyridinyl group at the 4-position. The presence of the pyridine moiety contributes to its potential biological activity, as pyridine derivatives are often involved in various pharmacological effects. The compound is typically characterized by its molecular structure, which influences its solubility, reactivity, and interaction with biological targets. It may exhibit properties such as being a potential ligand for receptors or enzymes, making it of interest in medicinal chemistry and drug development. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR spectroscopy and mass spectrometry, to confirm its structure and purity. Overall, 1-Methyl-4-(3-methyl-2-pyridinyl)piperazine represents a compound with potential applications in pharmacology and medicinal chemistry.
Formula:C11H17N3
InChI:InChI=1S/C11H17N3/c1-10-4-3-5-12-11(10)14-8-6-13(2)7-9-14/h3-5H,6-9H2,1-2H3
InChI key:InChIKey=ZXHBYUGQYALQNM-UHFFFAOYSA-N
SMILES:N=1C=CC=C(C1N2CCN(C)CC2)C
- Synonyms:
- 1-Methyl-4-(3-methyl-2-pyridinyl)piperazine
- Piperazine, 1-methyl-4-(3-methyl-2-pyridinyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(4-Methylpiperazino)-3-picoline REF: IN-DA003EHYCAS: 1187386-43-1 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 1-Methyl-4-(3-methylpyridin-2-yl)piperazine REF: 54-OR902129CAS: 1187386-43-1 | 96% | 194.00 €~480.00 € | Thu 03 Apr 25 |
![]() | 1-Methyl-4-(3-methylpyridin-2-yl)piperazine REF: 10-F636470CAS: 1187386-43-1 | 96% | - - - | Discontinued product |
![]() | 1-Methyl-4-(3-methylpyridin-2-yl)piperazine REF: 3D-MXB38643CAS: 1187386-43-1 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA003EHY
Undefined size | To inquire |

Ref: 54-OR902129
1g | 194.00 € | ||
5g | 480.00 € |

1-Methyl-4-(3-methylpyridin-2-yl)piperazine
Ref: 10-F636470
1g | Discontinued | Request information | |
5g | Discontinued | Request information |

1-Methyl-4-(3-methylpyridin-2-yl)piperazine
Ref: 3D-MXB38643
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |