
CAS 1190314-14-7: 5-Bromo-3-chloro-4-methyl-1H-pyrrolo[2,3-b]pyridine
Description:5-Bromo-3-chloro-4-methyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents on the aromatic system enhances its reactivity and potential for further chemical modifications. This compound typically exhibits a pale yellow to brown solid appearance and is soluble in organic solvents, making it suitable for various synthetic applications. Its molecular structure suggests potential biological activity, which may be explored in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's CAS number, 1190314-14-7, allows for precise identification in chemical databases. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns. Overall, 5-Bromo-3-chloro-4-methyl-1H-pyrrolo[2,3-b]pyridine represents a valuable building block in organic synthesis and drug discovery.
Formula:C8H6BrClN2
InChI:InChI=1S/C8H6BrClN2/c1-4-5(9)2-11-8-7(4)6(10)3-12-8/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=LSMWCDNKVGLAMR-UHFFFAOYSA-N
SMILES:ClC1=CNC2=NC=C(Br)C(=C12)C
- Synonyms:
- 5-Bromo-3-chloro-4-methyl-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-3-chloro-4-methyl-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1H-Pyrrolo[2,3-b]pyridine, 5-broMo-3-chloro-4-Methyl- REF: IN-DA000HLICAS: 1190314-14-7 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 5-bromo-3-chloro-4-methyl-1H-Pyrrolo[2,3-b]pyridine REF: 10-F600241CAS: 1190314-14-7 | 95+% | - - - | Discontinued product |
![]() | 5-Bromo-3-chloro-4-methyl-1H-pyrrolo[2,3-b]pyridine REF: 3D-QXB31414CAS: 1190314-14-7 | Min. 95% | - - - | Discontinued product |

1H-Pyrrolo[2,3-b]pyridine, 5-broMo-3-chloro-4-Methyl-
Ref: IN-DA000HLI
Undefined size | To inquire |

5-bromo-3-chloro-4-methyl-1H-Pyrrolo[2,3-b]pyridine
Ref: 10-F600241
1g | Discontinued | Request information |

5-Bromo-3-chloro-4-methyl-1H-pyrrolo[2,3-b]pyridine
Ref: 3D-QXB31414
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
100mg | Discontinued | Request information |