CAS 1190318-93-4: 4-Bromo-1,3-dihydro-2H-pyrrolo[2,3-c]pyridin-2-one
Description:4-Bromo-1,3-dihydro-2H-pyrrolo[2,3-c]pyridin-2-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrrolidine and a pyridine ring. The presence of a bromine atom at the 4-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its molecular structure suggests potential biological activity, making it of interest in drug discovery and development. The compound may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the functional groups present. Additionally, its specific stereochemistry and electronic properties can influence its interaction with biological targets, which is crucial for understanding its pharmacological potential. Overall, 4-Bromo-1,3-dihydro-2H-pyrrolo[2,3-c]pyridin-2-one represents a valuable scaffold for further research in organic synthesis and medicinal chemistry.
Formula:C7H5BrN2O
InChI:InChI=1S/C7H5BrN2O/c8-5-2-9-3-6-4(5)1-7(11)10-6/h2-3H,1H2,(H,10,11)
InChI key:InChIKey=KZNIAYMPFKNABU-UHFFFAOYSA-N
SMILES:O=C1NC=2C=NC=C(Br)C2C1
- Synonyms:
- 4-Bromo-1,3-dihydro-2H-pyrrolo[2,3-c]pyridin-2-one
- 2H-Pyrrolo[2,3-c]pyridin-2-one, 4-bromo-1,3-dihydro-

4-Bromo-1H-pyrrolo[2,3-c]pyridin-2(3H)-one
Ref: 10-F210822
1g | 472.00 € | ||
250mg | 233.00 € |

2H-Pyrrolo[2,3-c]pyridin-2-one, 4-bromo-1,3-dihydro-
Ref: IN-DA000HT2
1g | To inquire | ||
100mg | 193.00 € | ||
250mg | 255.00 € | ||
500mg | 478.00 € |

4-Bromo-1H-pyrrolo[2,3-c]pyridin-2(3H)-one
Ref: 3D-FB155615
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |