CAS 1190318-93-4: 4-Bromo-1,3-dihydro-2H-pyrrolo[2,3-c]pyridin-2-one

Description:4-Bromo-1,3-dihydro-2H-pyrrolo[2,3-c]pyridin-2-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrrolidine and a pyridine ring. The presence of a bromine atom at the 4-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its molecular structure suggests potential biological activity, making it of interest in drug discovery and development. The compound may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the functional groups present. Additionally, its specific stereochemistry and electronic properties can influence its interaction with biological targets, which is crucial for understanding its pharmacological potential. Overall, 4-Bromo-1,3-dihydro-2H-pyrrolo[2,3-c]pyridin-2-one represents a valuable scaffold for further research in organic synthesis and medicinal chemistry.

Formula:C₇H₅BrN₂O

InChI:InChI=1S/C7H5BrN2O/c8-5-2-9-3-6-4(5)1-7(11)10-6/h2-3H,1H2,(H,10,11)

InChI key:InChIKey=KZNIAYMPFKNABU-UHFFFAOYSA-N

SMILES:O=C1NC=2C=NC=C(Br)C2C1

Synonyms:
4-Bromo-1,3-dihydro-2H-pyrrolo[2,3-c]pyridin-2-one
2H-Pyrrolo[2,3-c]pyridin-2-one, 4-bromo-1,3-dihydro-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4-Bromo-1H-pyrrolo[2,3-c]pyridin-2(3H)-one REF: 10-F210822CAS: 1190318-93-4	95.0%	233.00 €~472.00 €	Mon 24 Feb 25
2H-Pyrrolo[2,3-c]pyridin-2-one, 4-bromo-1,3-dihydro- REF: IN-DA000HT2CAS: 1190318-93-4	95%	193.00 €~510.00 €	Mon 03 Mar 25
4-Bromo-1H-pyrrolo[2,3-c]pyridin-2(3H)-one REF: 54-OR85558CAS: 1190318-93-4	0.95	429.00 €~1,052.00 €	Tue 04 Mar 25
4-Bromo-1H-pyrrolo[2,3-c]pyridin-2(3H)-one REF: 3D-FB155615CAS: 1190318-93-4	Min. 95%	- - -	Discontinued product