CAS 1191-85-1: 5,8,11,14-eicosatetraynoic acid
Description:5,8,11,14-eicosatetraynoic acid, also known as a polyunsaturated fatty acid, is characterized by its long carbon chain consisting of 20 carbon atoms and four triple bonds located at the 5th, 8th, 11th, and 14th positions. This structure classifies it as a member of the family of fatty acids known for their potential health benefits and roles in biological systems. The presence of multiple triple bonds contributes to its reactivity and influences its physical properties, such as melting point and solubility. Typically, such compounds are found in certain plant oils and can be involved in various biochemical processes, including cellular signaling and membrane fluidity. Additionally, 5,8,11,14-eicosatetraynoic acid may exhibit anti-inflammatory properties and could be of interest in nutritional and pharmaceutical research. Its unique structure allows it to participate in various chemical reactions, making it a subject of study in organic chemistry and biochemistry.
Formula:C20H24O2
InChI:InChI=1/C20H24O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-5,8,11,14,17-19H2,1H3,(H,21,22)
- Synonyms:
- Etya
- Icosa-5,8,11,14-Tetraynoic Acid
- 5,8,11,14-Eicosatetraynoic acid
