CAS 119185-58-9: 4-cyclohexyl-3-mercapto-4,5-dihydro-1H-1,2,4-triazol-5-one
Description:4-Cyclohexyl-3-mercapto-4,5-dihydro-1H-1,2,4-triazol-5-one is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a cyclohexyl group, contributing to its hydrophobic characteristics, and a mercapto (-SH) group, which imparts thiol properties, making it reactive in various chemical contexts. The presence of the dihydro form indicates that it has two hydrogen atoms added to the triazole ring, enhancing its stability and reactivity. This compound may exhibit biological activity, potentially serving as a pharmacophore in medicinal chemistry, particularly in the development of antimicrobial or antifungal agents. Its unique structure allows for various interactions with biological targets, making it a subject of interest in research. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the cyclohexyl group and the mercapto functionality, which may affect its applications in both synthetic and pharmaceutical chemistry.
Formula:C8H13N3OS
InChI:InChI=1S/C8H13N3OS/c12-7-9-10-8(13)11(7)6-4-2-1-3-5-6/h6H,1-5H2,(H,9,12)(H,10,13)
InChI key:InChIKey=XLRPFBACBJJYFG-UHFFFAOYSA-N
SMILES:O=C1NNC(=S)N1C2CCCCC2
- Synonyms:
- 1,2,4-Triazolidin-3-one, 4-cyclohexyl-5-thioxo-
- 4-Cyclohexyl-5-Thioxo-1,2,4-Triazolidin-3-One
- Bicarbamimide, N-cyclohexyl-1-thio-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1,2,4-Triazolidin-3-one, 4-cyclohexyl-5-thioxo- REF: IN-DA000IAGCAS: 119185-58-9 | - - - | To inquire | Mon 03 Mar 25 |
 | 4-Cyclohexyl-5-mercapto-4H-1,2,4-triazol-3-ol REF: 54-OR110034CAS: 119185-58-9 | - - - | 125.00 € | Tue 04 Mar 25 |
 | 4-cyclohexyl-5-mercapto-2,4-dihydro-3H-1,2,4-triazol-3-one REF: 10-F374287CAS: 119185-58-9 | - - - | - - - | Discontinued product |
 | 4-Cyclohexyl-5-mercapto-2,4-dihydro-3H-1,2,4-triazol-3-one REF: 3D-FC132179CAS: 119185-58-9 | Min. 95% | - - - | Discontinued product |
1,2,4-Triazolidin-3-one, 4-cyclohexyl-5-thioxo-
Ref: IN-DA000IAG
| Undefined size | To inquire |
Ref: 54-OR110034
| 1g | 125.00 € |
4-cyclohexyl-5-mercapto-2,4-dihydro-3H-1,2,4-triazol-3-one
Ref: 10-F374287
| 1g | Discontinued | Request information |
4-Cyclohexyl-5-mercapto-2,4-dihydro-3H-1,2,4-triazol-3-one
Ref: 3D-FC132179
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
