CAS 119192-10-8: 1-(4-Aminobenzyl)-1,2,4-triazole
Description:1-(4-Aminobenzyl)-1,2,4-triazole is an organic compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features an amino group attached to a benzyl moiety, contributing to its potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, which is common for many triazole derivatives. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound has garnered interest in medicinal chemistry, particularly for its potential applications in pharmaceuticals, including antifungal and anticancer activities. Its CAS number, 119192-10-8, allows for precise identification in chemical databases. As with many triazole derivatives, it may exhibit a range of biological properties, making it a subject of research in various fields, including biochemistry and pharmacology. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C9H10N4
InChI:InChI=1S/C9H10N4/c10-9-3-1-8(2-4-9)5-13-7-11-6-12-13/h1-4,6-7H,5,10H2
InChI key:InChIKey=ZGLQVRIVLWGDNA-UHFFFAOYSA-N
SMILES:N=1C=NN(C1)CC2=CC=C(N)C=C2
- Synonyms:
- 1-(4-Aminobenzyl)-1,2,4-triazole
- 1-(4-Aminobenzyl)-1H-1,2,4-triazole
- 4-(1H-1,2,4-triazol-1-yl methyl)aniline
- 4-(1H-1,2,4-triazol-1-yl-methyl) benzeneamine
- 4-(1H-1,2,4-triazol-1-ylmethyl)-benzenamine
- 4-[(1,2,4-Triazol-1-yl)methyl]aniline
- Benzenamine, 4-(1H-1,2,4-triazol-1-ylmethyl)-
- [4-[(1H-[1,2,4]Triazol-1-yl)methyl]phenyl]amine
- [4-[([1,2,4]Triazol-1-yl)methyl]phenyl]amine
- 4-(1H-1,2,4-Triazol-1-ylmethyl)aniline
- See more synonyms
