CAS 1192352-10-5: 4,7-Bis(5-bromo-2-thienyl)-5,6-bis(octyloxy)-2,1,3-benzothiadiazole
Description:4,7-Bis(5-bromo-2-thienyl)-5,6-bis(octyloxy)-2,1,3-benzothiadiazole is an organic compound characterized by its complex structure, which includes a benzothiadiazole core substituted with thienyl and octyloxy groups. The presence of bromine atoms enhances its electronic properties, making it potentially useful in electronic applications such as organic photovoltaics and organic light-emitting diodes (OLEDs). The octyloxy substituents contribute to its solubility in organic solvents, which is advantageous for processing in various applications. This compound exhibits notable photophysical properties, including absorption and emission characteristics that can be tuned by modifying the substituents. Additionally, the thienyl groups may impart unique electronic interactions, influencing the compound's conductivity and overall performance in electronic devices. Its structural features suggest potential applications in materials science, particularly in the development of organic semiconductors. Overall, this compound exemplifies the intricate relationship between molecular structure and functional properties in organic chemistry.
Formula:C30H38Br2N2O2S3
InChI:InChI=1S/C30H38Br2N2O2S3/c1-3-5-7-9-11-13-19-35-29-25(21-15-17-23(31)37-21)27-28(34-39-33-27)26(22-16-18-24(32)38-22)30(29)36-20-14-12-10-8-6-4-2/h15-18H,3-14,19-20H2,1-2H3
- Synonyms:
- 4,7-Bis(5-bromothiophen-2-yl)-5,6-bis(octyloxy)benzo[c][1,2,5]thiadiazole
- K0495

2,1,3-Benzothiadiazole, 4,7-bis(5-bromo-2-thienyl)-5,6-bis(octyloxy)-
Ref: IN-DA000IF4
1g | To inquire | ||
250mg | 198.00 € |

4,7-Bis(5-bromothiophen-2-yl)-5,6-bis(n-octyloxy)-2,1,3-benzothiadiazole
Ref: 3B-B5753
200mg | 187.00 € |

4,7-Bis(5-bromothiophen-2-yl)-5,6-bis(n-octyloxy)-2,1,3-benzothiadiazole
Ref: 3D-SXB35210
1g | Discontinued | Request information | |
500mg | Discontinued | Request information |