CAS 1194-04-3: Pyridinium, 4-cyano-1-methyl-, iodide (1:1)

Description:Pyridinium, 4-cyano-1-methyl-, iodide (1:1), with the CAS number 1194-04-3, is a quaternary ammonium salt characterized by its pyridinium cation and iodide anion. The structure features a pyridine ring substituted at the 4-position with a cyano group and at the 1-position with a methyl group, contributing to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar solvents, which is common for ionic compounds. It exhibits notable reactivity due to the presence of the cyano group, which can participate in various chemical reactions, including nucleophilic additions. The iodide ion can also act as a leaving group in substitution reactions. Pyridinium salts are often used in organic synthesis and as intermediates in the preparation of other chemical compounds. Additionally, the presence of the cyano group may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted, as with all chemical substances, to understand its handling and potential hazards.

Formula:C₇H₇N₂·I

InChI:InChI=1S/C7H7N2.HI/c1-9-4-2-7(6-8)3-5-9;/h2-5H,1H3;1H/q+1;/p-1

InChI key:InChIKey=HQYMOWHFGSCKGU-UHFFFAOYSA-M

SMILES:[I-].N#CC1=CC=[N+](C=C1)C

Synonyms:
1-Methyl-4-cyanopyridinium iodide
4-Cyano-1-Methylpyridinium
4-Cyano-N-methylpyridinium iodide
4-Cyanopyridine methiodide
N-Methyl-4-cyanopyridinium iodide
Pyridinium, 4-Cyano-1-Methyl-
Pyridinium, 4-cyano-1-methyl-, iodide
Pyridinium, 4-cyano-1-methyl-, iodide (1:1)
4-Cyano-1-methylpyridinium iodide

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Pyridinium, 4-cyano-1-methyl-, iodide (1:1) REF: IN-DA000IP0CAS: 1194-04-3	- - -	To inquire	Mon 03 Mar 25
4-Cyano-1-methylpyridinium iodide REF: 10-F181502CAS: 1194-04-3	- - -	To inquire	Thu 13 Mar 25
4-Cyano-1-methylpyridin-1-ium iodide REF: 3D-BAA19404CAS: 1194-04-3	Min. 95%	To inquire	Mon 14 Apr 25