
CAS 1196152-51-8: Morpholine, 2-(trifluoromethyl)-, hydrochloride (1:1)
Description:Morpholine, 2-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its morpholine structure, which is a six-membered ring containing one nitrogen atom and five carbon atoms. The presence of a trifluoromethyl group (-CF3) significantly influences its chemical properties, enhancing its lipophilicity and potentially altering its reactivity. As a hydrochloride salt, it is typically encountered in a solid form, which is soluble in water and polar organic solvents. This compound may exhibit basic properties due to the morpholine moiety, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Its trifluoromethyl group can also impart unique electronic characteristics, making it useful in medicinal chemistry and material science. Safety data should be consulted, as the trifluoromethyl group can contribute to toxicity and environmental persistence. Overall, this compound's unique structure and properties make it of interest in various chemical applications, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C5H8F3NO·ClH
InChI:InChI=1S/C5H8F3NO.ClH/c6-5(7,8)4-3-9-1-2-10-4;/h4,9H,1-3H2;1H
InChI key:InChIKey=INIKTCFEWCCJMM-UHFFFAOYSA-N
SMILES:Cl.FC(F)(F)C1OCCNC1
- Synonyms:
- 2-(Trifluoromethyl)morpholine hydrochloride
- Morpholine, 2-(trifluoromethyl)-, hydrochloride (1:1)

2-Trifluoromethyl-morpholine hydrochloride
Ref: IN-DA0092GC
1g | 151.00 € | ||
5g | 545.00 € | ||
10g | To inquire | ||
25g | To inquire | ||
100mg | 103.00 € | ||
250mg | 106.00 € | ||
500mg | 183.00 € |

2-(trifluoromethyl)morpholine hydrochloride
Ref: 10-F330374
1g | 158.00 € | ||
5g | 465.00 € | ||
2.5g | 353.00 € | ||
100mg | 53.00 € | ||
250mg | 54.00 € | ||
500mg | 99.00 € |

2-(Trifluoromethyl)morpholine hydrochloride
Ref: 54-PC305012
Undefined size | To inquire |

2-(Trifluoromethyl)morpholine Hydrochloride
Controlled ProductRef: TR-T791773
500mg | 3,864.00 € |

2-(Trifluoromethyl)morpholine hydrochloride
Ref: 3D-FT176487
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |