CAS 1196155-73-3: Isoquinoline, 1-bromo-7-chloro-

Description:Isoquinoline, 1-bromo-7-chloro- is a heterocyclic organic compound characterized by its isoquinoline backbone, which consists of a fused benzene and pyridine ring structure. The presence of bromine and chlorine substituents at the 1 and 7 positions, respectively, introduces significant reactivity and influences its chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with isoquinoline derivatives. The presence of halogen atoms can enhance its reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, isoquinoline derivatives are often studied for their roles in biological systems, including their potential as enzyme inhibitors or in other therapeutic contexts. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula:C₉H₅BrClN

InChI:InChI=1S/C9H5BrClN/c10-9-8-5-7(11)2-1-6(8)3-4-12-9/h1-5H

InChI key:InChIKey=OOPNOHVOHJARSZ-UHFFFAOYSA-N

SMILES:ClC=1C=CC=2C=CN=C(Br)C2C1

Synonyms:
Isoquinoline, 1-bromo-7-chloro-
1-Bromo-7-chloroisoquinoline

Found 5 products.

Product data	Purity	Price range	Estimated delivery
Isoquinoline, 1-bromo-7-chloro- REF: IN-DA000PBPCAS: 1196155-73-3	97%	To inquire	Tue 04 Mar 25
1-Bromo-7-chloroisoquinoline REF: 54-OR300112CAS: 1196155-73-3	- - -	101.00 €	Mon 03 Mar 25
1-Bromo-7-chloroisoquinoline REF: FT-B13923CAS: 1196155-73-3	>95%	To inquire	Wed 05 Mar 25
1-Bromo-7-chloroisoquinoline REF: 10-F216742CAS: 1196155-73-3	95.0%	To inquire	Wed 12 Mar 25
1-Bromo-7-chloroisoquinoline REF: 3D-WXB15573CAS: 1196155-73-3	Min. 95%	- - -	Discontinued product