CAS 1197-55-3: 4-Aminophenylacetic acid
Description:4-Aminophenylacetic acid, with the CAS number 1197-55-3, is an organic compound characterized by the presence of both an amino group and a carboxylic acid group attached to a phenyl ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water and organic solvents, reflecting its polar nature due to the functional groups. It has a molecular formula that indicates the presence of carbon, hydrogen, nitrogen, and oxygen atoms, contributing to its chemical reactivity and potential applications. 4-Aminophenylacetic acid is often utilized in pharmaceutical research and synthesis, particularly as an intermediate in the production of various drugs and biologically active compounds. Its structural features allow it to participate in various chemical reactions, including acylation and amination, making it a valuable building block in organic synthesis. Additionally, it may exhibit biological activity, which warrants further investigation into its pharmacological properties and potential therapeutic uses.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5,9H2,(H,10,11)
InChI key:InChIKey=CSEWAUGPAQPMDC-UHFFFAOYSA-N
SMILES:O=C(O)CC1=CC=C(N)C=C1
- Synonyms:
- (4-Aminophenyl)Acetate
- 2-(4-Aminophenyl)Acetic Acid
- 4-(Carboxymethyl)aniline
- 4-Aminobenzeneacetic acid
- 4-Aminophenyl acetate HCl
- 4-Aminophenyl acetic acid
- Acetic Acid 4-Aminophenyl Ester
- Acetic acid, (p-aminophenyl)-
- Akos Bbs-00006880
- Benzeneacetic acid, 4-amino-
- See more synonyms
- H-4-Aph-Oh
- H-Aph(4)-Oh
- NSC 7929
- Rarechem Al Bo 0220
- p-Aminophenylacetic acid
- 4-Aminophenylacetic acid
