CAS 119844-66-5: (5S)-5-methylmorpholin-3-one

Description:(5S)-5-methylmorpholin-3-one, with the CAS number 119844-66-5, is a chemical compound characterized by its morpholine structure, which includes a six-membered ring containing both nitrogen and oxygen atoms. This compound features a methyl group at the 5-position and a carbonyl group at the 3-position, contributing to its unique properties. It is typically a solid at room temperature and is soluble in polar solvents, which is common for morpholine derivatives. The presence of the nitrogen atom in the ring allows for potential basicity and reactivity in various chemical reactions, making it useful in synthetic organic chemistry. Additionally, the specific stereochemistry indicated by the (5S) designation suggests that it has a defined spatial arrangement, which can influence its biological activity and interactions with other molecules. Overall, (5S)-5-methylmorpholin-3-one is of interest in pharmaceutical and chemical research due to its structural features and potential applications.

Formula:C₅H₉NO₂

InChI:InChI=1/C5H9NO2/c1-4-2-8-3-5(7)6-4/h4H,2-3H2,1H3,(H,6,7)/t4-/m0/s1

Synonyms:
3-morpholinone, 5-methyl-, (5S)-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
3-Morpholinone, 5-methyl-, (5S)- REF: IN-DA000PS9CAS: 119844-66-5	98%	39.00 €~190.00 €	Thu 27 Mar 25
(S)-5-methylmorpholin-3-one REF: 54-OR74675CAS: 119844-66-5	0.95	116.00 €~413.00 €	Fri 28 Mar 25
(S)-5-Methylmorpholin-3-one REF: 10-F232849CAS: 119844-66-5	95.0%	61.00 €~224.00 €	Tue 01 Apr 25
(5S)-5-Methylmorpholin-3-one REF: 3D-UEA84466CAS: 119844-66-5	Min. 95%	- - -	Discontinued product