CAS 119895-95-3: DTPA-BMA
Description:DTPA-BMA, or Diethylenetriaminepentaacetic acid-bis(methyl acrylate), is a chelating agent that features a diethylenetriamine backbone with five acetic acid groups, which allows it to effectively bind metal ions. The presence of the bis(methyl acrylate) moiety enhances its reactivity, making it useful in various applications, including radiopharmaceuticals and as a polymerization agent. DTPA-BMA is characterized by its ability to form stable complexes with a range of metal ions, which is particularly valuable in medical imaging and therapeutic contexts. The compound is typically soluble in water and exhibits a high affinity for divalent and trivalent metal ions. Its structure allows for potential modifications, enabling the development of targeted delivery systems in drug design. Additionally, DTPA-BMA's properties make it suitable for use in environmental applications, such as metal ion remediation. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C16H29N5O8
InChI:InChI=1S/C16H29N5O8/c1-17-12(22)7-20(10-15(26)27)5-3-19(9-14(24)25)4-6-21(11-16(28)29)8-13(23)18-2/h3-11H2,1-2H3,(H,17,22)(H,18,23)(H,24,25)(H,26,27)(H,28,29)
InChI key:InChIKey=RZESKRXOCXWCFX-UHFFFAOYSA-N
SMILES:O=C(O)CN(CC(=O)NC)CCN(CC(=O)O)CCN(CC(=O)O)CC(=O)NC
- Synonyms:
- 2,5,8,11-Tetraazatridecan-13-oic acid, 5,8-bis(carboxymethyl)-11-[2-(methylamino)-2-oxoethyl]-3-oxo-
- 5,8-Bis(carboxymethyl)-11-[2-(methylamino)-2-oxoethyl]-3-oxo-2,5,8,11-tetraazatridecan-13-oic acid
- N,N-bis(2-{(carboxymethyl)[2-(methylamino)-2-oxoethyl]amino}ethyl)glycine
- DTPA-BMA
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2,5,8,11-Tetraazatridecan-13-oic acid, 5,8-bis(carboxymethyl)-11-[2-(methylamino)-2-oxoethyl]-3-oxo- REF: IN-DA000PTXCAS: 119895-95-3 | - - - | To inquire | Thu 27 Mar 25 |
![]() | Dtpa-bma REF: 3D-UEA89595CAS: 119895-95-3 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | Dtpa-bma REF: TR-D895950CAS: 119895-95-3 | - - - | - - - | Discontinued product |

2,5,8,11-Tetraazatridecan-13-oic acid, 5,8-bis(carboxymethyl)-11-[2-(methylamino)-2-oxoethyl]-3-oxo-
Ref: IN-DA000PTX
Undefined size | To inquire |

Dtpa-bma
Ref: 3D-UEA89595
25mg | 1,068.00 € | ||
50mg | 1,486.00 € | ||
100mg | 2,377.00 € |

Dtpa-bma
Controlled ProductRef: TR-D895950
1mg | Discontinued | Request information | |
2mg | Discontinued | Request information | |
10mg | Discontinued | Request information |