CAS 1199-03-7: 2,3-Dimercaptoquinoxaline
Description:2,3-Dimercaptoquinoxaline is a chemical compound characterized by its unique structure, which includes a quinoxaline ring substituted with two mercapto (-SH) groups at the 2 and 3 positions. This compound is known for its chelating properties, allowing it to form complexes with heavy metals, which makes it of interest in various fields, including biochemistry and environmental science. It is often studied for its potential applications in detoxifying heavy metal ions and as a protective agent against metal-induced toxicity. The presence of the thiol groups contributes to its reactivity, making it a valuable compound in research related to metal ion interactions. Additionally, 2,3-Dimercaptoquinoxaline may exhibit biological activity, although specific pharmacological effects can vary and require further investigation. Safety data indicates that, like many thiol-containing compounds, it should be handled with care due to potential toxicity and reactivity. Overall, its unique chemical properties and potential applications make it a compound of interest in both academic and industrial research.
Formula:C8H6N2S2
InChI:InChI=1S/C8H6N2S2/c11-7-8(12)10-6-4-2-1-3-5(6)9-7/h1-4H,(H,9,11)(H,10,12)
InChI key:InChIKey=YFBUDXNMBTUSOC-UHFFFAOYSA-N
SMILES:S=C1NC=2C=CC=CC2NC1=S
- Synonyms:
- 1,4-Dihydro-2,3-quinoxalinedithione
- 1,4-Dihydroquinoxaline-2,3-Dithione
- 2,3-Dimercaptoquinoxaline
- 2,3-Dithiolquinoxaline
- 2,3-Quinoxalinedithiol
- 2,3-Quinoxalinedithione, 1,4-dihydro-
- 2,3-Quinoxalinethiol
- Nsc 56344
- Nsc 63917
- Nsc 9434
- See more synonyms
- QDT
- Usaf Ek-7317
- Quinoxaline-2,3-dithiol
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2,3-Quinoxalinedithione, 1,4-dihydro- REF: IN-DA000PU9CAS: 1199-03-7 | - - - | To inquire | Thu 27 Mar 25 |
![]() | Quinoxaline-2,3-dithiol REF: 10-F038847CAS: 1199-03-7 | 90.0% | - - - | Discontinued product |
![]() | Quinoxaline-2,3-dithiol REF: 3D-FQ131399CAS: 1199-03-7 | Min. 95% | - - - | Discontinued product |

2,3-Quinoxalinedithione, 1,4-dihydro-
Ref: IN-DA000PU9
Undefined size | To inquire |

Ref: 10-F038847
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

Quinoxaline-2,3-dithiol
Ref: 3D-FQ131399
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |