CAS 1199215-88-7: 5-Chloro-3-(trifluoromethyl)-1H-1,2,4-triazole
Description:5-Chloro-3-(trifluoromethyl)-1H-1,2,4-triazole is a heterocyclic compound characterized by its triazole ring, which consists of three nitrogen atoms and two carbon atoms. The presence of a chlorine atom at the 5-position and a trifluoromethyl group at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is known for its stability under various conditions. It exhibits moderate solubility in polar organic solvents, which can facilitate its use in various chemical reactions and applications. The trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the compound may exhibit fungicidal or herbicidal properties, which are valuable in agricultural applications. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further investigation in medicinal chemistry. Safety data should be consulted to understand its handling and toxicity profiles.
Formula:C3HClF3N3
InChI:InChI=1S/C3HClF3N3/c4-2-8-1(9-10-2)3(5,6)7/h(H,8,9,10)
InChI key:InChIKey=XRZFEFMCIGCKEH-UHFFFAOYSA-N
SMILES:FC(F)(F)C1=NN=C(Cl)N1
- Synonyms:
- 1H-1,2,4-Triazole, 5-chloro-3-(trifluoromethyl)-
- 5-Chloro-3-(trifluoromethyl)-1H-1,2,4-triazole
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-chloro-3-(trifluoromethyl)-1H-1,2,4-triazole REF: IN-DA008V8ZCAS: 1199215-88-7 | 95% | 207.00 €~578.00 € | Mon 03 Mar 25 |
![]() | 3-chloro-5-(trifluoromethyl)-1H-1,2,4-triazole REF: 10-F309851CAS: 1199215-88-7 | 95.0% | To inquire | Thu 13 Mar 25 |
![]() | 3-Chloro-5-(trifluoromethyl)-1H-1,2,4-triazole REF: 3D-FC121990CAS: 1199215-88-7 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
5-chloro-3-(trifluoromethyl)-1H-1,2,4-triazole
Ref: IN-DA008V8Z
1g | 578.00 € | ||
250mg | 207.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
3-chloro-5-(trifluoromethyl)-1H-1,2,4-triazole
Ref: 10-F309851
1g | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
3-Chloro-5-(trifluoromethyl)-1H-1,2,4-triazole
Ref: 3D-FC121990
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |