CAS 1199773-08-4: 2-Bromo-1-(2-pyridinyl)-1-butanone
Description:2-Bromo-1-(2-pyridinyl)-1-butanone is an organic compound characterized by the presence of a bromine atom, a pyridine ring, and a ketone functional group. Its molecular structure features a butanone backbone, where the bromine substituent is located at the first carbon, and a pyridine ring is attached to the second carbon. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic characteristics. The presence of the bromine atom enhances its reactivity, making it useful in various chemical synthesis applications, particularly in the formation of carbon-carbon bonds and as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the pyridine moiety contributes to its potential biological activity, as many pyridine-containing compounds exhibit significant pharmacological properties. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactivity and potential toxicity.
Formula:C9H10BrNO
InChI:InChI=1S/C9H10BrNO/c1-2-7(10)9(12)8-5-3-4-6-11-8/h3-7H,2H2,1H3
InChI key:InChIKey=PMAMKVXETFDLHM-UHFFFAOYSA-N
SMILES:O=C(C1=NC=CC=C1)C(Br)CC
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-Butanone, 2-bromo-1-(2-pyridinyl)- REF: IN-DA000PWKCAS: 1199773-08-4 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 2-Bromo-1-(pyridin-2-yl)butan-1-one REF: 10-F211322CAS: 1199773-08-4 | 95.0% | - - - | Discontinued product |
![]() | 2-Bromo-1-(pyridin-2-yl)butan-1-one REF: 3D-ZXB77308CAS: 1199773-08-4 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA000PWK
Undefined size | To inquire |

2-Bromo-1-(pyridin-2-yl)butan-1-one
Ref: 10-F211322
1g | Discontinued | Request information | |
5g | Discontinued | Request information |

2-Bromo-1-(pyridin-2-yl)butan-1-one
Ref: 3D-ZXB77308
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |