CAS 120-08-1: Scoparone
Description:Scoparone, with the CAS number 120-08-1, is a naturally occurring compound classified as a coumarin derivative. It is primarily found in various plants, particularly in the genus Scoparia, and is known for its distinctive aromatic properties. Scoparone exhibits a pale yellow to colorless appearance and is characterized by its sweet, pleasant fragrance, which contributes to its use in perfumery and flavoring. Chemically, it has a molecular formula that includes a benzopyran structure, which is typical of coumarins, and it possesses various functional groups that contribute to its biological activity. Scoparone has been studied for its potential pharmacological effects, including anti-inflammatory, antioxidant, and antimicrobial properties. Additionally, it may play a role in traditional medicine practices. Its solubility varies depending on the solvent, and it is generally soluble in organic solvents while being less soluble in water. As with many natural compounds, the specific characteristics and effects of scoparone can be influenced by its concentration and the presence of other compounds in a mixture.
Formula:C11H10O4
InChI:InChI=1S/C11H10O4/c1-13-9-5-7-3-4-11(12)15-8(7)6-10(9)14-2/h3-6H,1-2H3
InChI key:InChIKey=GUAFOGOEJLSQBT-UHFFFAOYSA-N
SMILES:O=C1OC=2C=C(OC)C(OC)=CC2C=C1
- Synonyms:
- 2H-1-Benzopyran-2-one, 6,7-dimethoxy-
- 6,7-Dimethoxy-2H-1-benzopyran-2-one
- 6,7-Dimethylesculetin
- 6,7-dimethoxy-2H-chromen-2-one
- Aesculetin dimethyl ether
- Coumarin, 6,7-dimethoxy-
- Escoparone
- Esculetin 6,7-dimethyl ether
- Esculetin dimethyl ether
- Nrb 03190
- See more synonyms
- O,O-Dimethylesculetin
- O-Methylisoscopoletin
- O-Methylscopoletin
- Scoparon
- Scoparone
- Scopoletin methyl ether
- Scopoletin monomethyl ether
- 6,7-Dimethoxycoumarin
