CAS 120-65-0: 2-[(Dimethylamino)methyl]phenol
Description:2-[(Dimethylamino)methyl]phenol, also known as 2-(N,N-dimethylaminomethyl)phenol, is an organic compound characterized by its phenolic structure with a dimethylamino group attached to a methylene bridge. This compound typically appears as a solid or viscous liquid and is known for its role as a chemical intermediate in the synthesis of various dyes, pharmaceuticals, and agrochemicals. It exhibits properties such as being soluble in organic solvents and having moderate polarity due to the presence of both hydrophobic and hydrophilic functional groups. The dimethylamino group contributes to its basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, 2-[(Dimethylamino)methyl]phenol can undergo oxidation and other transformations, making it versatile in synthetic organic chemistry. Safety considerations include potential irritant effects and the need for proper handling due to its chemical reactivity. Overall, this compound is significant in industrial applications and research settings, particularly in the development of new materials and chemical processes.
Formula:C9H13NO
InChI:InChI=1S/C9H13NO/c1-10(2)7-8-5-3-4-6-9(8)11/h3-6,11H,7H2,1-2H3
InChI key:InChIKey=FUIQBJHUESBZNU-UHFFFAOYSA-N
SMILES:OC=1C=CC=CC1CN(C)C
- Synonyms:
- (2-Hydroxybenzyl)dimethylamine
- 2-(Dimethylaminomethyl)phenol
- 2-Dimethylaminomethylphenol (contains phenol)
- 2-[(Dimethylamino)Methyl]Phenol
- N,N-Dimethyl-2-hydroxybenzylamine
- N,N-Dimethyl-o-hydroxybenzylamine
- NSC 12220
- Phenol, 2-[(dimethylamino)methyl]-
- o-(Dimethylaminomethyl)phenol
- o-Cresol, α-(dimethylamino)-
- See more synonyms
- o-Hydroxy-N,N-dimethylbenzylamine
- α-(Dimethylamino)-o-cresol
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Dimethylaminomethylphenol (contains Phenol) REF: 3B-D0655CAS: 120-65-0 | >70.0%(GC) | 31.00 € | Thu 20 Mar 25 |
![]() | Phenol, 2-[(dimethylamino)methyl]- REF: IN-DA000Q0MCAS: 120-65-0 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 2-((Dimethylamino)methyl)phenol REF: 10-F766909CAS: 120-65-0 | 98% | - - - | Discontinued product |
![]() | 2-(Dimethylaminomethyl)phenol - contains phenol REF: 3D-AAA12065CAS: 120-65-0 | Min. 70 Area-% | - - - | Discontinued product |

2-Dimethylaminomethylphenol (contains Phenol)
Ref: 3B-D0655
25ml | 31.00 € |

Phenol, 2-[(dimethylamino)methyl]-
Ref: IN-DA000Q0M
Undefined size | To inquire |

Ref: 10-F766909
25g | Discontinued | Request information |

2-(Dimethylaminomethyl)phenol - contains phenol
Ref: 3D-AAA12065
5ml | Discontinued | Request information | |
25ml | Discontinued | Request information | |
50ml | Discontinued | Request information | |
100ml | Discontinued | Request information | |
250ml | Discontinued | Request information |