CAS 120004-79-7: 7-(4-Chlorobutoxy)-3,4-dihydro-2(1H)-quinolinone
Description:7-(4-Chlorobutoxy)-3,4-dihydro-2(1H)-quinolinone is a chemical compound characterized by its unique structure, which includes a quinolinone core modified with a 4-chlorobutoxy group. This compound typically exhibits properties associated with both the quinoline and ether functional groups, potentially influencing its solubility, reactivity, and biological activity. The presence of the chlorine atom may enhance lipophilicity and alter the compound's interaction with biological targets. As a dihydroquinolinone, it may exhibit various pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in drug development, particularly in areas targeting neurological or cardiovascular conditions. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, this compound represents a class of molecules that may hold promise for further research and application in pharmaceuticals.
Formula:C13H16ClNO2
InChI:InChI=1S/C13H16ClNO2/c14-7-1-2-8-17-11-5-3-10-4-6-13(16)15-12(10)9-11/h3,5,9H,1-2,4,6-8H2,(H,15,16)
InChI key:InChIKey=SRMLSNBGMDJSJH-UHFFFAOYSA-N
SMILES:O=C1NC2=CC(OCCCCCl)=CC=C2CC1
- Synonyms:
- 2(1H)-Quinolinone, 7-(4-chlorobutoxy)-3,4-dihydro-
- 7-(4-Chlorobutoxy)-3,4-Dihydro-2(1H)-Quinolone
- 7-(4-Chlorobutoxy)-3,4-Dihydro-2(1H)-quinoline
- 7-(4-Chlorobutoxy)-3,4-Dihydro2(1H)-Quinolinone
- 7-(4-Chlorobutoxy)-3,4-Dihydroc2(1H)-Quinolinone
- 7-(4-Chlorobutoxy)-3,4-dihydro-2(1H)-quinolinone
- 7-(4-Chlorobutoxy)-3,4-dihydro-C2(1 H)-quinoline
- 7-(4-Chlorobutoxy)-3,4-dihydrocarbostyril
- 7-(4-chlorobutoxy)-3,4-dihydroquinolin-2(1H)-one
- Arp-B-7-(4-Halobutoxy)-3,4-Dihydrocarbostyril
- See more synonyms
- 3,4-Dihydro-7-(4-chlorobutoxy)-2(1H)-quinolinone
