CAS 120218-46-4: Benzenemethanamine, N-cyclobutyl-, hydrochloride (1:1)
Description:Benzenemethanamine, N-cyclobutyl-, hydrochloride (1:1), also known by its CAS number 120218-46-4, is a chemical compound characterized by its amine functional group and a cyclobutyl substituent. This compound features a benzene ring attached to a methanamine moiety, with the cyclobutyl group providing unique steric and electronic properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in aqueous solutions. The presence of the amine group suggests potential basicity and reactivity, making it relevant in various chemical reactions, including those involving nucleophilic substitution. Its structural characteristics may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the compound's properties, such as melting point, solubility, and reactivity, can be influenced by the presence of the hydrochloride, which can affect its behavior in different environments. Overall, this compound is significant in both synthetic chemistry and potential applications in medicinal chemistry.
Formula:C11H15N·ClH
InChI:InChI=1S/C11H15N.ClH/c1-2-5-10(6-3-1)9-12-11-7-4-8-11;/h1-3,5-6,11-12H,4,7-9H2;1H
InChI key:InChIKey=WWHWFPCTEMNQNY-UHFFFAOYSA-N
SMILES:Cl.C=1C=CC(=CC1)CNC2CCC2
- Synonyms:
- Benzenemethanamine, N-cyclobutyl-, hydrochloride
- Benzenemethanamine, N-cyclobutyl-, hydrochloride (1:1)
- N-Cyclobutylbenzylamine hydrochloride
- N-Benzylcyclobutanamine hydrochloride (1:1)

BENZYL-CYCLOBUTYL-AMINE HCL
Ref: IN-DA008V6A
1g | 242.00 € | ||
5g | To inquire |

Benzyl-cyclobutyl-amine hydrochloride
Ref: 10-F046336
1g | To inquire | ||
5g | To inquire | ||
250mg | To inquire |

Benzyl-cyclobutyl-amine hydrochloride
Ref: 3D-VEA21846
5g | 1,488.00 € | ||
500mg | 470.00 € |