CAS 120244-82-8: 3-(4-chlorophenyl)-N,N-dimethyl-3-(2-pyridyl)propan-1-amine oxide

Description:3-(4-chlorophenyl)-N,N-dimethyl-3-(2-pyridyl)propan-1-amine oxide, with the CAS number 120244-82-8, is a chemical compound characterized by its complex structure, which includes a chlorophenyl group, a dimethylamino group, and a pyridyl moiety. This compound is classified as an amine oxide, indicating the presence of an oxygen atom bonded to a nitrogen atom that is also connected to carbon chains. The chlorophenyl group contributes to its potential biological activity, while the pyridyl ring may enhance its interaction with various biological targets. The presence of the dimethylamino group suggests that the compound may exhibit basic properties. In terms of solubility, amine oxides are generally polar, which can influence their behavior in biological systems and their potential applications in pharmaceuticals or agrochemicals. The compound's specific reactivity and interactions would depend on its functional groups and overall molecular geometry, making it of interest for further research in medicinal chemistry and related fields.

Formula:C₁₆H₁₉ClN₂O

InChI:InChI=1S/C16H19ClN2O/c1-19(2,20)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3

InChI key:InChIKey=NMEICKDXQPVPKK-UHFFFAOYSA-N

SMILES:O=N(C)(C)CCC(C1=NC=CC=C1)C2=CC=C(Cl)C=C2

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Chlorphenamine N-Oxide HCl REF: 4Z-C-482CAS: 120244-82-8	- - -	To inquire	Tue 04 Mar 25
Chlorpheniramine-d6 N-Oxide Dihydrochloride REF: TR-C424312CAS: 120244-82-8 1246816-73-8 2984490-45-9	- - -	1,568.00 €	Fri 11 Apr 25
Chlorpheniramine N-oxide REF: 3D-FC183438CAS: 120244-82-8	Min. 95%	To inquire	Mon 28 Apr 25