CAS 1202805-22-8: N-Cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrimidinamine
Description:N-Cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrimidinamine is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a boron-containing moiety. The presence of the cyclopentyl group contributes to its hydrophobic characteristics, while the dioxaborolane group enhances its potential for reactivity, particularly in applications involving boron chemistry. This compound is likely to exhibit properties typical of pyrimidine derivatives, such as potential biological activity, making it of interest in medicinal chemistry. The dioxaborolane moiety may also facilitate interactions with biological targets or serve as a functional group for further chemical modifications. Its specific applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and reactivity. As with many compounds containing boron, it may also exhibit unique coordination chemistry, which could be relevant in various synthetic pathways. Overall, N-Cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrimidinamine represents a versatile structure with potential utility in diverse chemical contexts.
Formula:C15H24BN3O2
InChI:InChI=1S/C15H24BN3O2/c1-14(2)15(3,4)21-16(20-14)11-9-17-13(18-10-11)19-12-7-5-6-8-12/h9-10,12H,5-8H2,1-4H3,(H,17,18,19)
InChI key:InChIKey=AEHCJEOTWNMLFO-UHFFFAOYSA-N
SMILES:N=1C=C(C=NC1NC2CCCC2)B3OC(C)(C)C(O3)(C)C

N-Cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine
Ref: IN-DA003SXF
Undefined size | To inquire |

2-(Cyclopentylamino)pyrimidine-5-boronic acid, pinacol ester
Ref: 54-OR361066
Undefined size | To inquire |

N-Cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine
Ref: 10-F228500
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |

2-(Cyclopentylamino)pyrimidine-5-boronic acid, pinacol ester
Ref: 3D-FC160143
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |