CAS 1203-99-2: 1-(5-chloro-1H-indol-3-yl)propan-2-amine

Description:1-(5-chloro-1H-indol-3-yl)propan-2-amine, also known by its CAS number 1203-99-2, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a propan-2-amine side chain, which contributes to its amine functionality. The presence of a chlorine atom at the 5-position of the indole ring influences its reactivity and biological activity. Typically, compounds of this nature may exhibit various pharmacological properties, potentially acting as neurotransmitter modulators or having implications in medicinal chemistry. The compound is likely to be a solid at room temperature and may be soluble in organic solvents, depending on its specific structure and substituents. Its synthesis and applications are of interest in research, particularly in the fields of organic chemistry and drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula:C₁₁H₁₃ClN₂

InChI:InChI=1/C11H13ClN2/c1-7(13)4-8-6-14-11-3-2-9(12)5-10(8)11/h2-3,5-7,14H,4,13H2,1H3