CAS 1203797-93-6: Methyl 3-(3-azetidinyl)benzoate
Description:Methyl 3-(3-azetidinyl)benzoate is a chemical compound characterized by its ester functional group, which is derived from benzoic acid and methanol. The presence of the azetidine ring, a four-membered nitrogen-containing heterocycle, contributes to its unique structural and chemical properties. This compound typically exhibits moderate polarity due to the ester and amine functionalities, influencing its solubility in various organic solvents. Methyl 3-(3-azetidinyl)benzoate may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it of interest in synthetic organic chemistry. Its potential applications could span medicinal chemistry, where derivatives may exhibit biological activity, and materials science, where it could serve as a building block for more complex molecules. Safety and handling considerations are essential, as with many organic compounds, due to potential toxicity or reactivity. Overall, the compound's unique structure and functional groups make it a subject of interest for further research and application in various chemical fields.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c1-14-11(13)9-4-2-3-8(5-9)10-6-12-7-10/h2-5,10,12H,6-7H2,1H3
InChI key:InChIKey=JHLQDXKTVTYSDO-UHFFFAOYSA-N
SMILES:O=C(OC)C1=CC=CC(=C1)C2CNC2
- Synonyms:
- Benzoic acid, 3-(3-azetidinyl)-, methyl ester
- Methyl 3-(3-azetidinyl)benzoate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Methyl 3-(azetidin-3-yl)benzoate REF: 10-F625984CAS: 1203797-93-6 | 98% | - - - | Discontinued product |
![]() | METHYL 4-(AZETIDIN-3-YL)BENZOATE HCL REF: 10-F388353CAS: 1203797-93-6 | 95.0% | - - - | Discontinued product |
![]() | Methyl 3-(azetidin-3-yl)benzoate REF: 3D-DYB79793CAS: 1203797-93-6 | Min. 95% | - - - | Discontinued product |

Ref: 10-F625984
1g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

METHYL 4-(AZETIDIN-3-YL)BENZOATE HCL
Ref: 10-F388353
1g | Discontinued | Request information | |
250mg | Discontinued | Request information |

Methyl 3-(azetidin-3-yl)benzoate
Ref: 3D-DYB79793
10mg | Discontinued | Request information | |
100mg | Discontinued | Request information |