CAS 1204-86-0: 4-morpholinobenzaldehyde
Description:4-Morpholinobenzaldehyde is an organic compound characterized by the presence of a morpholine ring and an aldehyde functional group attached to a benzene ring. Its molecular structure features a benzaldehyde moiety, which contributes to its reactivity and potential applications in organic synthesis. The morpholine ring, a six-membered heterocycle containing both nitrogen and oxygen, imparts unique properties such as increased solubility in polar solvents and the ability to participate in various chemical reactions. This compound typically appears as a pale yellow to light brown solid or liquid, depending on its purity and form. It is known for its role as an intermediate in the synthesis of pharmaceuticals and agrochemicals, as well as in the development of various organic compounds. Additionally, 4-morpholinobenzaldehyde may exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c13-9-10-1-3-11(4-2-10)12-5-7-14-8-6-12/h1-4,9H,5-8H2
InChI key:InChIKey=FOAQOAXQMISINY-UHFFFAOYSA-N
SMILES:O=CC1=CC=C(C=C1)N2CCOCC2
- Synonyms:
- 4-(4-Morpholinyl)benzaldehyde
- 4-Morpholin-4-yl-benzaldehyde
- Benzaldehyde, 4-(4-morpholinyl)-
- Benzaldehyde, p-morpholino-
- N-(4-Formylphenyl)morpholine
- NSC 156543
- p-Morpholinobenzaldehyde
- 4-Morpholinobenzaldehyde

4-Morpholinobenzaldehyde
Ref: IN-DA008SB6
1g | 24.00 € | ||
5g | 49.00 € | ||
10g | 66.00 € | ||
25g | 103.00 € | ||
100g | 217.00 € |

4-Morpholin-4-ylbenzaldehyde
Ref: 54-OR23267
250mg | 32.00 € |

4-(4-Formylphenyl)morpholine
Ref: 3B-M1625
1g | 22.00 € | ||
5g | 43.00 € | ||
25g | 153.00 € |

4-Morpholin-4-yl-benzaldehyde
Ref: 10-F031193
1g | 24.00 € | ||
5g | 34.00 € | ||
10g | 54.00 € | ||
25g | 80.00 € | ||
100g | 264.00 € |

4-(4-Morpholinyl)benzaldehyde
Ref: 3D-FM01962
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |