CAS 1204298-65-6: 5-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid
Description:5-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a difluoromethyl group, which contributes to its unique reactivity and potential applications in medicinal chemistry. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions and may serve as a precursor for various chemical transformations. The methyl group attached to the pyrazole ring can influence the compound's lipophilicity and biological activity. This compound is of interest in pharmaceutical research, particularly for its potential as a building block in the synthesis of bioactive molecules. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. Overall, 5-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid represents a versatile structure in organic synthesis and drug development.
Formula:C6H6F2N2O2
InChI:InChI=1S/C6H6F2N2O2/c1-10-4(5(7)8)3(2-9-10)6(11)12/h2,5H,1H3,(H,11,12)
InChI key:InChIKey=CTTXMUZEFPPHGD-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=NN(C1C(F)F)C
- Synonyms:
- 1H-Pyrazole-4-carboxylic acid, 5-(difluoromethyl)-1-methyl-
- 5-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid
- 5-Difluoromethyl-1-methyl-1H-pyrazole-4-carboxylic acid

5-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid
Ref: IN-DA003M7B
1g | 463.00 € | ||
5g | To inquire | ||
10g | To inquire | ||
100mg | 113.00 € | ||
250mg | 178.00 € |

5-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid
Ref: 54-PC910578
1g | 702.00 € | ||
5g | 1,675.00 € | ||
10g | 2,702.00 € | ||
100mg | 171.00 € | ||
250mg | 265.00 € |

5-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid
Ref: 10-F320832
1g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |

5-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic Acid
Controlled ProductRef: TR-D445348
100mg | 2,353.00 € |

5-(Difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid
Ref: 3D-FD95446
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |