CAS 1204600-17-8: 4-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Description:4-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is an organic compound characterized by its pyridine ring, which is substituted with a chlorine atom and a boron-containing moiety. The presence of the chloro group introduces electrophilic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The dioxaborolane group contributes to the compound's stability and reactivity, particularly in cross-coupling reactions, which are essential in synthetic organic chemistry. This compound is typically used in the synthesis of more complex molecules, especially in the development of pharmaceuticals and agrochemicals. Its unique structure allows for the formation of boron-containing intermediates, which can facilitate the formation of carbon-carbon bonds. Additionally, the steric hindrance provided by the tetramethyl groups can influence the reactivity and selectivity of the compound in chemical reactions. Overall, 4-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a valuable building block in organic synthesis.
Formula:C11H15BClNO2
InChI:InChI=1S/C11H15BClNO2/c1-10(2)11(3,4)16-12(15-10)9-7-8(13)5-6-14-9/h5-7H,1-4H3
InChI key:InChIKey=GYLWLVSGDPGRIV-UHFFFAOYSA-N
SMILES:ClC=1C=CN=C(C1)B2OC(C)(C)C(O2)(C)C
- Synonyms:
- 4-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
- Pyridine, 4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-CHLOROPYRIDINE-2-BORONIC ACID PINACOL ESTER REF: IN-DA008XFRCAS: 1204600-17-8 | - - - | To inquire | Mon 24 Mar 25 |
![]() | 4-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine REF: 10-F617342CAS: 1204600-17-8 | 95+% | - - - | Discontinued product |
![]() | 4-Chloropyridine-2-boronic acid pinacol ester REF: 3D-EYB60017CAS: 1204600-17-8 | Min. 95% | - - - | Discontinued product |

4-CHLOROPYRIDINE-2-BORONIC ACID PINACOL ESTER
Ref: IN-DA008XFR
Undefined size | To inquire |

4-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Ref: 10-F617342
1g | Discontinued | Request information |

4-Chloropyridine-2-boronic acid pinacol ester
Ref: 3D-EYB60017
1g | Discontinued | Request information | |
10mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |