CAS 1204669-37-3: Epacadostat

Description:Epacadostat, with the CAS number 1204669-37-3, is a small molecule inhibitor primarily targeting the enzyme indoleamine 2,3-dioxygenase 1 (IDO1). This enzyme plays a crucial role in the metabolism of tryptophan, leading to the production of immunosuppressive metabolites that can inhibit T-cell function and promote tumor immune evasion. By inhibiting IDO1, Epacadostat aims to enhance the immune response against tumors, making it a candidate for cancer immunotherapy. The compound is characterized by its ability to modulate the immune system, potentially improving the efficacy of other cancer treatments, such as checkpoint inhibitors. Epacadostat has been investigated in various clinical trials, often in combination with other therapeutic agents, to evaluate its safety, tolerability, and effectiveness in treating different types of cancer. Its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, are essential for determining optimal dosing regimens in clinical settings. Overall, Epacadostat represents a promising approach in the evolving landscape of cancer treatment strategies.

Formula:C₁₁H₁₃BrFN₇O₄S

InChI:InChI=1S/C11H13BrFN7O4S/c12-7-5-6(1-2-8(7)13)17-11(18-21)9-10(20-24-19-9)15-3-4-16-25(14,22)23/h1-2,5,16,21H,3-4H2,(H,15,20)(H,17,18)(H2,14,22,23)

InChI key:InChIKey=FBKMWOJEPMPVTQ-UHFFFAOYSA-N

SMILES:O=S(=O)(N)NCCNC1=NON=C1C(=NO)NC2=CC=C(F)C(Br)=C2

Synonyms:
1,2,5-Oxadiazole-3-carboximidamide, 4-[[2-[(aminosulfonyl)amino]ethyl]amino]-N-(3-bromo-4-fluorophenyl)-N′-hydroxy-, [C(Z)]-
[C(Z)]-4-[[2-[(Aminosulfonyl)amino]ethyl]amino]-N-(3-bromo-4-fluorophenyl)-N′-hydroxy-1,2,5-oxadiazole-3-carboximidamide
Epacadostat
ICBN 24360
INCB 024360