CAS 1205-30-7: 4-Chloro-3-Sulfamoyl Benzoic Acid
Description:4-Chloro-3-sulfamoyl benzoic acid, with the CAS number 1205-30-7, is an aromatic sulfonamide compound characterized by the presence of a chloro group and a sulfonamide functional group attached to a benzoic acid structure. This compound typically appears as a white to off-white crystalline solid. It is soluble in polar solvents such as water and methanol, while being less soluble in non-polar solvents. The presence of the sulfonamide group imparts certain biological activities, making it of interest in pharmaceutical applications, particularly as a potential antimicrobial agent. The chloro substituent can influence the compound's reactivity and interaction with biological targets. Additionally, 4-chloro-3-sulfamoyl benzoic acid may exhibit acidic properties due to the carboxylic acid group, allowing it to participate in various chemical reactions, including esterification and amidation. Safety data should be consulted for handling and potential hazards, as with any chemical substance.
Formula:C7H5ClNO4S
InChI:InChI=1S/C7H6ClNO4S/c8-5-2-1-4(7(10)11)3-6(5)14(9,12)13/h1-3H,(H,10,11)(H2,9,12,13)
InChI key:InChIKey=FHQAWINGVCDTTG-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=C(Cl)C(=C1)S(=O)(=O)N
- Synonyms:
- 3-(Aminosulfonyl)-4-Chloro-Benzoicaci
- 3-(Aminosulfonyl)-4-chlorobenzoic Acid
- 3-Sulfamoyl-4-chlorobenzoic acid
- 3-Sulfamyl-4-chlorobenzoic acid
- 4-Chloro-3-(aminosulfonyl)benzoic acid
- 4-Chloro-3-Sulfaminebenzoic Acid
- 4-Chloro-3-Sulfamoyl-Benzoicaci
- 4-Chloro-3-Sulfamoylbenzoate
- 4-Chloro-3-Sulfamoylbenzoic Acid
- 4-Chloro-3-Sulfomulbenzoic Acid
- See more synonyms
- 4-Chloro-3-Sulfonamidobenzoic Acid
- 4-Chloro-3-Sulphamoylbenzoic Acid
- 4-Chloro-5-Sulphamoylbenzoic Acid
- 4-Chloro-5-sulfamoylbenzoic acid
- Benzoic acid, 3-(aminosulfonyl)-4-chloro-
- Benzoic acid, 4-chloro-3-sulfamoyl-
- Csba
