CAS 1208076-48-5: 1-(6-Bromo-2,3-difluorophenyl)-2,2,2-trifluoroethanone
Description:1-(6-Bromo-2,3-difluorophenyl)-2,2,2-trifluoroethanone is a synthetic organic compound characterized by its complex fluorinated structure. It features a trifluoroethanone moiety, which contributes to its reactivity and potential applications in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The presence of bromine and difluorine substituents on the phenyl ring enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit significant polarity due to the electronegative fluorine atoms, which can affect its solubility in different solvents. Additionally, the bromine atom may impart unique electronic properties, making it a valuable intermediate in organic synthesis. As with many fluorinated compounds, it may exhibit stability under various conditions, but its reactivity can be influenced by the presence of functional groups. Safety and handling precautions are essential due to the potential toxicity associated with halogenated compounds. Overall, this compound represents a specialized class of fluorinated chemicals with potential utility in advanced materials and medicinal chemistry.
Formula:C8H2BrF5O
InChI:InChI=1S/C8H2BrF5O/c9-3-1-2-4(10)6(11)5(3)7(15)8(12,13)14/h1-2H
InChI key:InChIKey=JKNSBIVANGAQRU-UHFFFAOYSA-N
SMILES:O=C(C1=C(F)C(F)=CC=C1Br)C(F)(F)F
- Synonyms:
- Ethanone, 1-(6-bromo-2,3-difluorophenyl)-2,2,2-trifluoro-
- 1-(6-Bromo-2,3-difluorophenyl)-2,2,2-trifluoroethanone
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 6’-Bromo-2,2,2,2’,3’-pentafluoroacetophenone REF: 54-PC56925CAS: 1208076-48-5 | 97% | 203.00 €~1,569.00 € | Fri 28 Mar 25 |
 | 1-(6-Bromo-2,3-difluorophenyl)-2,2,2-trifluoroethan-1-one REF: 10-F776840CAS: 1208076-48-5 | 98% | - - - | Discontinued product |
 | 6’-Bromo-2,2,2,2’,3’-pentafluoroacetophenone REF: 3D-IYB07648CAS: 1208076-48-5 | Min. 95% | - - - | Discontinued product |
6’-Bromo-2,2,2,2’,3’-pentafluoroacetophenone
Ref: 54-PC56925
| 1g | 574.00 € | ||
| 5g | 1,569.00 € | ||
| 250mg | 203.00 € |
1-(6-Bromo-2,3-difluorophenyl)-2,2,2-trifluoroethan-1-one
Ref: 10-F776840
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information |
6’-Bromo-2,2,2,2’,3’-pentafluoroacetophenone
Ref: 3D-IYB07648
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
