CAS 120889-75-0: 5-(aminomethyl)thiophene-2-carboxylic acid

Description:5-(Aminomethyl)thiophene-2-carboxylic acid is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the thiophene ring, contributing to its potential as a building block in pharmaceuticals and agrochemicals. The presence of the amino group allows for various chemical reactions, including amide formation and coupling reactions, while the carboxylic acid group can participate in esterification and other acid-base reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of functional groups. Its unique structure imparts specific reactivity and biological activity, making it of interest in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Overall, 5-(aminomethyl)thiophene-2-carboxylic acid is a versatile compound with significant implications in synthetic organic chemistry.

Formula:C₆H₇NO₂S

InChI:InChI=1/C6H7NO2S/c7-3-4-1-2-5(10-4)6(8)9/h1-2H,3,7H2,(H,8,9)

Synonyms:
2-Thiophenecarboxylic Acid, 5-(Aminomethyl)-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	5-(aminomethyl)thiophene-2-carboxylic acid REF: 10-F308322CAS: 120889-75-0	95.0%	- - -	Discontinued product
	5-(Aminomethyl)thiophene-2-carboxylic acid REF: 3D-VEA88975CAS: 120889-75-0	Min. 95%	- - -	Discontinued product